C49H33N5O9S — CID 132942361
[6'-[4-[2-(7-azido-2-oxochromen-4-yl)acetyl]piperazin-1-yl]-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] 2-benzoylsulfanylbenzoate (PubChem CID 132942361) has the molecular formula C49H33N5O9S and a molecular weight of 867.90 g/mol. Its IUPAC name is [6'-[4-[2-(7-azido-2-oxochromen-4-yl)acetyl]piperazin-1-yl]-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] 2-benzoylsulfanylbenzoate.
| Compound Name | [6'-[4-[2-(7-azido-2-oxochromen-4-yl)acetyl]piperazin-1-yl]-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] 2-benzoylsulfanylbenzoate |
|---|---|
| PubChem CID | 132942361 |
| Molecular Formula | C49H33N5O9S |
| Molecular Weight | 867.90 g/mol |
| Exact Mass | 867.20 |
| IUPAC Name | [6'-[4-[2-(7-azido-2-oxochromen-4-yl)acetyl]piperazin-1-yl]-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] 2-benzoylsulfanylbenzoate |
| SMILES | [N-]=[N+]=Nc1ccc2c(CC(=O)N3CCN(c4ccc5c(c4)Oc4cc(OC(=O)c6ccccc6SC(=O)c6ccccc6)ccc4C54OC(=O)c5ccccc54)CC3)cc(=O)oc2c1 |
| InChI | InChI=1S/C49H33N5O9S/c50-52-51-31-14-17-34-30(25-45(56)62-40(34)26-31)24-44(55)54-22-20-53(21-23-54)32-15-18-38-41(27-32)61-42-28-33(16-19-39(42)49(38)37-12-6-4-10-35(37)47(58)63-49)60-46(57)36-11-5-7-13-43(36)64-48(59)29-8-2-1-3-9-29/h1-19,25-28H,20-24H2 |
| InChIKey | ZMHGZSHXHURLBW-UHFFFAOYSA-N |
| XLogP | 9.35 |
| TPSA | 181.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.90 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|