C53H53BFN2O6P+ — CID 170528900
CID 170528900 (PubChem CID 170528900) has the molecular formula C53H53BFN2O6P+ and a molecular weight of 874.80 g/mol.
| Compound Name | CID 170528900 |
|---|---|
| PubChem CID | 170528900 |
| Molecular Formula | C53H53BFN2O6P+ |
| Molecular Weight | 874.80 g/mol |
| Exact Mass | 874.37 |
| IUPAC Name | — |
| SMILES | CC(C)(O)C(C)(C)O[B]c1ccc2c(c1CF)Oc1cc(N3CCN(C(=O)CCC[P+](c4ccccc4)(c4ccccc4)c4ccccc4)CC3)ccc1C21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C53H53BFN2O6P/c1-51(2,60)52(3,4)63-54-46-29-28-45-49(42(46)36-55)61-47-35-37(26-27-44(47)53(45)43-24-15-14-23-41(43)50(59)62-53)56-30-32-57(33-31-56)48(58)25-16-34-64(38-17-8-5-9-18-38,39-19-10-6-11-20-39)40-21-12-7-13-22-40/h5-15,17-24,26-29,35,60H,16,25,30-34,36H2,1-4H3/q+1 |
| InChIKey | OPJUJOUBNAYZAQ-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 874.80 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|