C35H32O8 — CID 134348979
[(2R,3S,4R)-3,5-dibenzoyloxy-4-methyl-4-(phenylmethoxymethyl)oxolan-2-yl]methyl benzoate (PubChem CID 134348979) has the molecular formula C35H32O8 and a molecular weight of 580.63 g/mol. Its IUPAC name is [(2R,3S,4R)-3,5-dibenzoyloxy-4-methyl-4-(phenylmethoxymethyl)oxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,4R)-3,5-dibenzoyloxy-4-methyl-4-(phenylmethoxymethyl)oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 134348979 |
| Molecular Formula | C35H32O8 |
| Molecular Weight | 580.63 g/mol |
| Exact Mass | 580.21 |
| IUPAC Name | [(2R,3S,4R)-3,5-dibenzoyloxy-4-methyl-4-(phenylmethoxymethyl)oxolan-2-yl]methyl benzoate |
| SMILES | C[C@]1(COCc2ccccc2)C(OC(=O)c2ccccc2)O[C@H](COC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C35H32O8/c1-35(24-39-22-25-14-6-2-7-15-25)30(42-32(37)27-18-10-4-11-19-27)29(23-40-31(36)26-16-8-3-9-17-26)41-34(35)43-33(38)28-20-12-5-13-21-28/h2-21,29-30,34H,22-24H2,1H3/t29-,30-,34?,35-/m1/s1 |
| InChIKey | SLLCBJIHWCZTMU-BEMGHKMNSA-N |
| XLogP | 5.87 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.63 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|