C14H17BrClN3O2 — CID 134360719
8-bromo-4-chloro-7-ethoxy-1,6-naphthyridine;morpholine (PubChem CID 134360719) has the molecular formula C14H17BrClN3O2 and a molecular weight of 374.67 g/mol. Its IUPAC name is 8-bromo-4-chloro-7-ethoxy-1,6-naphthyridine;morpholine.
| Compound Name | 8-bromo-4-chloro-7-ethoxy-1,6-naphthyridine;morpholine |
|---|---|
| PubChem CID | 134360719 |
| Molecular Formula | C14H17BrClN3O2 |
| Molecular Weight | 374.67 g/mol |
| Exact Mass | 373.02 |
| IUPAC Name | 8-bromo-4-chloro-7-ethoxy-1,6-naphthyridine;morpholine |
| SMILES | C1COCCN1.CCOc1ncc2c(Cl)ccnc2c1Br |
| InChI | InChI=1S/C10H8BrClN2O.C4H9NO/c1-2-15-10-8(11)9-6(5-14-10)7(12)3-4-13-9;1-3-6-4-2-5-1/h3-5H,2H2,1H3;5H,1-4H2 |
| InChIKey | DRVPUFLMDOPZFP-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.67 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |