About isoquinoline;morpholine
isoquinoline;morpholine (PubChem CID 161062345) has the molecular formula C13H16N2O
and a molecular weight of 216.28 g/mol. Its IUPAC name is isoquinoline;morpholine.
Molecular Properties
| Compound Name | isoquinoline;morpholine |
| PubChem CID | 161062345 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | isoquinoline;morpholine |
| SMILES | C1COCCN1.c1ccc2cnccc2c1 |
| InChI | InChI=1S/C9H7N.C4H9NO/c1-2-4-9-7-10-6-5-8(9)3-1;1-3-6-4-2-5-1/h1-7H;5H,1-4H2 |
| InChIKey | UDOGDVKPZLXROL-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze isoquinoline;morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isoquinoline;morpholine?
The IUPAC name of isoquinoline;morpholine (CID 161062345) is isoquinoline;morpholine.
What is the SMILES notation for isoquinoline;morpholine?
The canonical SMILES for isoquinoline;morpholine is C1COCCN1.c1ccc2cnccc2c1.
What is the InChIKey of isoquinoline;morpholine?
The InChIKey is UDOGDVKPZLXROL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C4H9NO/c1-2-4-9-7-10-6-5-8(9)3-1;1-3-6-4-2-5-1/h1-7H;5H,1-4H2.
What are the key properties of isoquinoline;morpholine?
isoquinoline;morpholine has a molecular weight of 216.28 g/mol, XLogP of 1.84, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for isoquinoline;morpholine is sourced from PubChem (CID 161062345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).