C15H26FN — CID 134365787
(5Z,7E)-7-fluoro-N,3-dimethyl-4-methylidene-N-propylnona-5,7-dien-1-amine (PubChem CID 134365787) has the molecular formula C15H26FN and a molecular weight of 239.38 g/mol. Its IUPAC name is (5Z,7E)-7-fluoro-N,3-dimethyl-4-methylidene-N-propylnona-5,7-dien-1-amine.
| Compound Name | (5Z,7E)-7-fluoro-N,3-dimethyl-4-methylidene-N-propylnona-5,7-dien-1-amine |
|---|---|
| PubChem CID | 134365787 |
| Molecular Formula | C15H26FN |
| Molecular Weight | 239.38 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | (5Z,7E)-7-fluoro-N,3-dimethyl-4-methylidene-N-propylnona-5,7-dien-1-amine |
| SMILES | C=C(/C=C\C(F)=C/C)C(C)CCN(C)CCC |
| InChI | InChI=1S/C15H26FN/c1-6-11-17(5)12-10-14(4)13(3)8-9-15(16)7-2/h7-9,14H,3,6,10-12H2,1-2,4-5H3/b9-8-,15-7+ |
| InChIKey | GVVUIWPSNSVPOS-WNVJXHEZSA-N |
| XLogP | 4.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.38 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|