C21H32O7 — CID 134386575
[(3S,3aR,6R,6aR)-6-(2-cyclopropylacetyl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 8-(oxiran-2-yl)octanoate (PubChem CID 134386575) has the molecular formula C21H32O7 and a molecular weight of 396.48 g/mol. Its IUPAC name is [(3S,3aR,6R,6aR)-6-(2-cyclopropylacetyl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 8-(oxiran-2-yl)octanoate.
| Compound Name | [(3S,3aR,6R,6aR)-6-(2-cyclopropylacetyl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 8-(oxiran-2-yl)octanoate |
|---|---|
| PubChem CID | 134386575 |
| Molecular Formula | C21H32O7 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | [(3S,3aR,6R,6aR)-6-(2-cyclopropylacetyl)oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 8-(oxiran-2-yl)octanoate |
| SMILES | O=C(CCCCCCCC1CO1)O[C@H]1CO[C@H]2[C@@H]1OC[C@H]2OC(=O)CC1CC1 |
| InChI | InChI=1S/C21H32O7/c22-18(7-5-3-1-2-4-6-15-11-24-15)27-16-12-25-21-17(13-26-20(16)21)28-19(23)10-14-8-9-14/h14-17,20-21H,1-13H2/t15?,16-,17+,20+,21+/m0/s1 |
| InChIKey | DJOBNFLRHZUNCO-VUXMUVPOSA-N |
| XLogP | 2.54 |
| TPSA | 83.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|