C53H91NO2 — CID 134388250
3-[7-[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]-2,4-dimethylheptan-2-yl]pyridine (PubChem CID 134388250) has the molecular formula C53H91NO2 and a molecular weight of 774.32 g/mol. Its IUPAC name is 3-[7-[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]-2,4-dimethylheptan-2-yl]pyridine.
| Compound Name | 3-[7-[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]-2,4-dimethylheptan-2-yl]pyridine |
|---|---|
| PubChem CID | 134388250 |
| Molecular Formula | C53H91NO2 |
| Molecular Weight | 774.32 g/mol |
| Exact Mass | 773.70 |
| IUPAC Name | 3-[7-[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]-2,4-dimethylheptan-2-yl]pyridine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC1(CCCCCCCC/C=C\C/C=C\CCCCC)OCC(CCCC(C)CC(C)(C)c2cccnc2)O1 |
| InChI | InChI=1S/C53H91NO2/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-43-53(44-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2)55-48-51(56-53)42-38-40-49(3)46-52(4,5)50-41-39-45-54-47-50/h14-17,20-23,39,41,45,47,49,51H,6-13,18-19,24-38,40,42-44,46,48H2,1-5H3/b16-14-,17-15-,22-20-,23-21- |
| InChIKey | FIMTZTKNUNKEIE-ZPPAUJSGSA-N |
| XLogP | 17.07 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.32 |
| LogP ≤ 5 | 17.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|