C16H25N3O5 — CID 134403254
(2,5-dioxopyrrolidin-1-yl) 5-[4-(dimethylamino)piperidin-1-yl]-5-oxopentanoate (PubChem CID 134403254) has the molecular formula C16H25N3O5 and a molecular weight of 339.39 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 5-[4-(dimethylamino)piperidin-1-yl]-5-oxopentanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 5-[4-(dimethylamino)piperidin-1-yl]-5-oxopentanoate |
|---|---|
| PubChem CID | 134403254 |
| Molecular Formula | C16H25N3O5 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 5-[4-(dimethylamino)piperidin-1-yl]-5-oxopentanoate |
| SMILES | CN(C)C1CCN(C(=O)CCCC(=O)ON2C(=O)CCC2=O)CC1 |
| InChI | InChI=1S/C16H25N3O5/c1-17(2)12-8-10-18(11-9-12)13(20)4-3-5-16(23)24-19-14(21)6-7-15(19)22/h12H,3-11H2,1-2H3 |
| InChIKey | QOZRFDYOZXAVIB-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|