C13H19NOS — CID 134430715
3-[(2E)-penta-2,4-dien-2-yl]oxy-N-(1-prop-1-en-2-ylsulfanylethenyl)prop-1-en-2-amine (PubChem CID 134430715) has the molecular formula C13H19NOS and a molecular weight of 237.37 g/mol. Its IUPAC name is 3-[(2E)-penta-2,4-dien-2-yl]oxy-N-(1-prop-1-en-2-ylsulfanylethenyl)prop-1-en-2-amine.
| Compound Name | 3-[(2E)-penta-2,4-dien-2-yl]oxy-N-(1-prop-1-en-2-ylsulfanylethenyl)prop-1-en-2-amine |
|---|---|
| PubChem CID | 134430715 |
| Molecular Formula | C13H19NOS |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 3-[(2E)-penta-2,4-dien-2-yl]oxy-N-(1-prop-1-en-2-ylsulfanylethenyl)prop-1-en-2-amine |
| SMILES | C=C/C=C(\C)OCC(=C)NC(=C)SC(=C)C |
| InChI | InChI=1S/C13H19NOS/c1-7-8-12(5)15-9-11(4)14-13(6)16-10(2)3/h7-8,14H,1-2,4,6,9H2,3,5H3/b12-8+ |
| InChIKey | KXANYAGEFNEDSG-XYOKQWHBSA-N |
| XLogP | 3.93 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|