C7H12F2N2 — CID 134438278
(3S,4S)-7,7-difluorobicyclo[4.1.0]heptane-3,4-diamine (PubChem CID 134438278) has the molecular formula C7H12F2N2 and a molecular weight of 162.18 g/mol. Its IUPAC name is (3S,4S)-7,7-difluorobicyclo[4.1.0]heptane-3,4-diamine.
| Compound Name | (3S,4S)-7,7-difluorobicyclo[4.1.0]heptane-3,4-diamine |
|---|---|
| PubChem CID | 134438278 |
| Molecular Formula | C7H12F2N2 |
| Molecular Weight | 162.18 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | (3S,4S)-7,7-difluorobicyclo[4.1.0]heptane-3,4-diamine |
| SMILES | N[C@H]1CC2C(C[C@@H]1N)C2(F)F |
| InChI | InChI=1S/C7H12F2N2/c8-7(9)3-1-5(10)6(11)2-4(3)7/h3-6H,1-2,10-11H2/t3?,4?,5-,6-/m0/s1 |
| InChIKey | NWAMXDHPAXHHKT-ULOPGSAPSA-N |
| XLogP | 0.32 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.18 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |