C7H12F2N2 — CID 21301277
7,7-difluorobicyclo[2.2.1]heptane-2,5-diamine (PubChem CID 21301277) has the molecular formula C7H12F2N2 and a molecular weight of 162.18 g/mol. Its IUPAC name is 7,7-difluorobicyclo[2.2.1]heptane-2,5-diamine.
| Compound Name | 7,7-difluorobicyclo[2.2.1]heptane-2,5-diamine |
|---|---|
| PubChem CID | 21301277 |
| Molecular Formula | C7H12F2N2 |
| Molecular Weight | 162.18 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 7,7-difluorobicyclo[2.2.1]heptane-2,5-diamine |
| SMILES | NC1CC2C(N)CC1C2(F)F |
| InChI | InChI=1S/C7H12F2N2/c8-7(9)3-1-5(10)4(7)2-6(3)11/h3-6H,1-2,10-11H2 |
| InChIKey | SZHSVRIOZJETQH-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.18 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |