C7H11F2NO — CID 130054075
4-amino-7,7-difluorobicyclo[4.1.0]heptan-3-ol (PubChem CID 130054075) has the molecular formula C7H11F2NO and a molecular weight of 163.17 g/mol. Its IUPAC name is 4-amino-7,7-difluorobicyclo[4.1.0]heptan-3-ol.
| Compound Name | 4-amino-7,7-difluorobicyclo[4.1.0]heptan-3-ol |
|---|---|
| PubChem CID | 130054075 |
| Molecular Formula | C7H11F2NO |
| Molecular Weight | 163.17 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | 4-amino-7,7-difluorobicyclo[4.1.0]heptan-3-ol |
| SMILES | NC1CC2C(CC1O)C2(F)F |
| InChI | InChI=1S/C7H11F2NO/c8-7(9)3-1-5(10)6(11)2-4(3)7/h3-6,11H,1-2,10H2 |
| InChIKey | DBYNWWZGTVQTFL-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.17 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |