C7H11F2N — CID 71758529
7,7-difluorobicyclo[2.2.1]heptan-2-amine (PubChem CID 71758529) has the molecular formula C7H11F2N and a molecular weight of 147.17 g/mol. Its IUPAC name is 7,7-difluorobicyclo[2.2.1]heptan-2-amine.
| Compound Name | 7,7-difluorobicyclo[2.2.1]heptan-2-amine |
|---|---|
| PubChem CID | 71758529 |
| Molecular Formula | C7H11F2N |
| Molecular Weight | 147.17 g/mol |
| Exact Mass | 147.09 |
| IUPAC Name | 7,7-difluorobicyclo[2.2.1]heptan-2-amine |
| SMILES | NC1CC2CCC1C2(F)F |
| InChI | InChI=1S/C7H11F2N/c8-7(9)4-1-2-5(7)6(10)3-4/h4-6H,1-3,10H2 |
| InChIKey | REKSYJSTVJQYJN-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.17 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |