C10H11F3N4O2 — CID 134442748
ethyl (2Z)-2-amino-2-[[2-(trifluoromethyl)-3-pyridinyl]hydrazinylidene]acetate (PubChem CID 134442748) has the molecular formula C10H11F3N4O2 and a molecular weight of 276.22 g/mol. Its IUPAC name is ethyl (2Z)-2-amino-2-[[2-(trifluoromethyl)-3-pyridinyl]hydrazinylidene]acetate.
| Compound Name | ethyl (2Z)-2-amino-2-[[2-(trifluoromethyl)-3-pyridinyl]hydrazinylidene]acetate |
|---|---|
| PubChem CID | 134442748 |
| Molecular Formula | C10H11F3N4O2 |
| Molecular Weight | 276.22 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | ethyl (2Z)-2-amino-2-[[2-(trifluoromethyl)-3-pyridinyl]hydrazinylidene]acetate |
| SMILES | CCOC(=O)/C(N)=N/Nc1cccnc1C(F)(F)F |
| InChI | InChI=1S/C10H11F3N4O2/c1-2-19-9(18)8(14)17-16-6-4-3-5-15-7(6)10(11,12)13/h3-5,16H,2H2,1H3,(H2,14,17) |
| InChIKey | LDEPQLPWONDXJW-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.22 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|