C27H41NO5 — CID 134457099
[[(2S,4aS,5S,6S)-2-ethenyl-5-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-6-methyl-3,4,5,6-tetrahydro-2H-naphthalen-4a-yl]amino]methyl 2,2-dimethylbutanoate (PubChem CID 134457099) has the molecular formula C27H41NO5 and a molecular weight of 459.63 g/mol. Its IUPAC name is [[(2S,4aS,5S,6S)-2-ethenyl-5-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-6-methyl-3,4,5,6-tetrahydro-2H-naphthalen-4a-yl]amino]methyl 2,2-dimethylbutanoate.
| Compound Name | [[(2S,4aS,5S,6S)-2-ethenyl-5-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-6-methyl-3,4,5,6-tetrahydro-2H-naphthalen-4a-yl]amino]methyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 134457099 |
| Molecular Formula | C27H41NO5 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.30 |
| IUPAC Name | [[(2S,4aS,5S,6S)-2-ethenyl-5-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-6-methyl-3,4,5,6-tetrahydro-2H-naphthalen-4a-yl]amino]methyl 2,2-dimethylbutanoate |
| SMILES | C=C[C@H]1C=C2C=C[C@H](C)[C@H](CC[C@@H]3C[C@@H](O)CC(=O)O3)[C@@]2(NCOC(=O)C(C)(C)CC)CC1 |
| InChI | InChI=1S/C27H41NO5/c1-6-19-12-13-27(28-17-32-25(31)26(4,5)7-2)20(14-19)9-8-18(3)23(27)11-10-22-15-21(29)16-24(30)33-22/h6,8-9,14,18-19,21-23,28-29H,1,7,10-13,15-17H2,2-5H3/t18-,19+,21+,22+,23-,27+/m0/s1 |
| InChIKey | DWWDRTUCAZBQRC-QPDWFNMCSA-N |
| XLogP | 4.44 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|