C10H10Cl2O2 — CID 134457567
2,4-dichloro-3-ethenyl-1,5-dimethoxybenzene (PubChem CID 134457567) has the molecular formula C10H10Cl2O2 and a molecular weight of 233.09 g/mol. Its IUPAC name is 2,4-dichloro-3-ethenyl-1,5-dimethoxybenzene.
| Compound Name | 2,4-dichloro-3-ethenyl-1,5-dimethoxybenzene |
|---|---|
| PubChem CID | 134457567 |
| Molecular Formula | C10H10Cl2O2 |
| Molecular Weight | 233.09 g/mol |
| Exact Mass | 232.01 |
| IUPAC Name | 2,4-dichloro-3-ethenyl-1,5-dimethoxybenzene |
| SMILES | C=Cc1c(Cl)c(OC)cc(OC)c1Cl |
| InChI | InChI=1S/C10H10Cl2O2/c1-4-6-9(11)7(13-2)5-8(14-3)10(6)12/h4-5H,1H2,2-3H3 |
| InChIKey | XASVJAHDMZSXGT-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.09 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |