C11H14ClIO2 — CID 121221215
2-chloro-4-iodo-1,5-dimethoxy-3-propylbenzene (PubChem CID 121221215) has the molecular formula C11H14ClIO2 and a molecular weight of 340.59 g/mol. Its IUPAC name is 2-chloro-4-iodo-1,5-dimethoxy-3-propylbenzene.
| Compound Name | 2-chloro-4-iodo-1,5-dimethoxy-3-propylbenzene |
|---|---|
| PubChem CID | 121221215 |
| Molecular Formula | C11H14ClIO2 |
| Molecular Weight | 340.59 g/mol |
| Exact Mass | 339.97 |
| IUPAC Name | 2-chloro-4-iodo-1,5-dimethoxy-3-propylbenzene |
| SMILES | CCCc1c(Cl)c(OC)cc(OC)c1I |
| InChI | InChI=1S/C11H14ClIO2/c1-4-5-7-10(12)8(14-2)6-9(15-3)11(7)13/h6H,4-5H2,1-3H3 |
| InChIKey | AZRNVFPBXVDXOH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.59 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|