C13H20F3N — CID 134466742
(E,2E)-3,5,5-trimethyl-2-(1,1,1-trifluoropropan-2-ylidene)hept-3-en-1-imine (PubChem CID 134466742) has the molecular formula C13H20F3N and a molecular weight of 247.30 g/mol. Its IUPAC name is (E,2E)-3,5,5-trimethyl-2-(1,1,1-trifluoropropan-2-ylidene)hept-3-en-1-imine.
| Compound Name | (E,2E)-3,5,5-trimethyl-2-(1,1,1-trifluoropropan-2-ylidene)hept-3-en-1-imine |
|---|---|
| PubChem CID | 134466742 |
| Molecular Formula | C13H20F3N |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | (E,2E)-3,5,5-trimethyl-2-(1,1,1-trifluoropropan-2-ylidene)hept-3-en-1-imine |
| SMILES | [H]/N=C/C(/C(C)=C/C(C)(C)CC)=C(\C)C(F)(F)F |
| InChI | InChI=1S/C13H20F3N/c1-6-12(4,5)7-9(2)11(8-17)10(3)13(14,15)16/h7-8,17H,6H2,1-5H3/b9-7+,11-10-,17-8+ |
| InChIKey | SIUHMSDTDZKUEA-YVMJFLRWSA-N |
| XLogP | 4.90 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|