C25H29N4PS — CID 134471130
1-[(2R)-3-(1,3-diphenyl-1,3,2-diazaphospholidin-2-yl)-2-methylpropyl]-3-phenylthiourea (PubChem CID 134471130) has the molecular formula C25H29N4PS and a molecular weight of 448.58 g/mol. Its IUPAC name is 1-[(2R)-3-(1,3-diphenyl-1,3,2-diazaphospholidin-2-yl)-2-methylpropyl]-3-phenylthiourea.
| Compound Name | 1-[(2R)-3-(1,3-diphenyl-1,3,2-diazaphospholidin-2-yl)-2-methylpropyl]-3-phenylthiourea |
|---|---|
| PubChem CID | 134471130 |
| Molecular Formula | C25H29N4PS |
| Molecular Weight | 448.58 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 1-[(2R)-3-(1,3-diphenyl-1,3,2-diazaphospholidin-2-yl)-2-methylpropyl]-3-phenylthiourea |
| SMILES | C[C@H](CNC(=S)Nc1ccccc1)CP1N(c2ccccc2)CCN1c1ccccc1 |
| InChI | InChI=1S/C25H29N4PS/c1-21(19-26-25(31)27-22-11-5-2-6-12-22)20-30-28(23-13-7-3-8-14-23)17-18-29(30)24-15-9-4-10-16-24/h2-16,21H,17-20H2,1H3,(H2,26,27,31)/t21-/m1/s1 |
| InChIKey | VRIULIZCPVYRMQ-OAQYLSRUSA-N |
| XLogP | 5.95 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.58 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|