C24H28N5PS — CID 134475085
1-[(2R)-2-[(1,3-diphenyl-1,3,2-diazaphospholidin-2-yl)amino]propyl]-3-phenylthiourea (PubChem CID 134475085) has the molecular formula C24H28N5PS and a molecular weight of 449.56 g/mol. Its IUPAC name is 1-[(2R)-2-[(1,3-diphenyl-1,3,2-diazaphospholidin-2-yl)amino]propyl]-3-phenylthiourea.
| Compound Name | 1-[(2R)-2-[(1,3-diphenyl-1,3,2-diazaphospholidin-2-yl)amino]propyl]-3-phenylthiourea |
|---|---|
| PubChem CID | 134475085 |
| Molecular Formula | C24H28N5PS |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | 1-[(2R)-2-[(1,3-diphenyl-1,3,2-diazaphospholidin-2-yl)amino]propyl]-3-phenylthiourea |
| SMILES | C[C@H](CNC(=S)Nc1ccccc1)NP1N(c2ccccc2)CCN1c1ccccc1 |
| InChI | InChI=1S/C24H28N5PS/c1-20(19-25-24(31)26-21-11-5-2-6-12-21)27-30-28(22-13-7-3-8-14-22)17-18-29(30)23-15-9-4-10-16-23/h2-16,20,27H,17-19H2,1H3,(H2,25,26,31)/t20-/m1/s1 |
| InChIKey | JVPIUDVNKLAKIC-HXUWFJFHSA-N |
| XLogP | 5.20 |
| TPSA | 42.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|