C24H27N4OPS — CID 118949793
1-[2-[(1,3-diphenyl-1,3,2-diazaphospholidin-2-yl)oxy]ethyl]-1-methyl-3-phenylthiourea (PubChem CID 118949793) has the molecular formula C24H27N4OPS and a molecular weight of 450.55 g/mol. Its IUPAC name is 1-[2-[(1,3-diphenyl-1,3,2-diazaphospholidin-2-yl)oxy]ethyl]-1-methyl-3-phenylthiourea.
| Compound Name | 1-[2-[(1,3-diphenyl-1,3,2-diazaphospholidin-2-yl)oxy]ethyl]-1-methyl-3-phenylthiourea |
|---|---|
| PubChem CID | 118949793 |
| Molecular Formula | C24H27N4OPS |
| Molecular Weight | 450.55 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 1-[2-[(1,3-diphenyl-1,3,2-diazaphospholidin-2-yl)oxy]ethyl]-1-methyl-3-phenylthiourea |
| SMILES | CN(CCOP1N(c2ccccc2)CCN1c1ccccc1)C(=S)Nc1ccccc1 |
| InChI | InChI=1S/C24H27N4OPS/c1-26(24(31)25-21-11-5-2-6-12-21)19-20-29-30-27(22-13-7-3-8-14-22)17-18-28(30)23-15-9-4-10-16-23/h2-16H,17-20H2,1H3,(H,25,31) |
| InChIKey | XSHFBDAAMHDTNH-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 30.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.55 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|