C23H16Cl2F3N3O3S — CID 134484126
7-chloro-1-[(11R)-10-chloro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-5-hydroxy-3-(2,2,2-trifluoroethyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione (PubChem CID 134484126) has the molecular formula C23H16Cl2F3N3O3S and a molecular weight of 542.37 g/mol. Its IUPAC name is 7-chloro-1-[(11R)-10-chloro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-5-hydroxy-3-(2,2,2-trifluoroethyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione.
| Compound Name | 7-chloro-1-[(11R)-10-chloro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-5-hydroxy-3-(2,2,2-trifluoroethyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
|---|---|
| PubChem CID | 134484126 |
| Molecular Formula | C23H16Cl2F3N3O3S |
| Molecular Weight | 542.37 g/mol |
| Exact Mass | 541.02 |
| IUPAC Name | 7-chloro-1-[(11R)-10-chloro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-5-hydroxy-3-(2,2,2-trifluoroethyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
| SMILES | O=C1c2c(O)c(=O)c(Cl)cn2N([C@@H]2c3ccccc3SCc3cccc(Cl)c32)CN1CC(F)(F)F |
| InChI | InChI=1S/C23H16Cl2F3N3O3S/c24-14-6-3-4-12-9-35-16-7-2-1-5-13(16)18(17(12)14)31-11-29(10-23(26,27)28)22(34)19-21(33)20(32)15(25)8-30(19)31/h1-8,18,33H,9-11H2/t18-/m1/s1 |
| InChIKey | IURAEZCUSWAFMK-GOSISDBHSA-N |
| XLogP | 5.17 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.37 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |