C16H24O3 — CID 134502371
2-[4-(2-hydroxybutan-2-yl)phenyl]ethyl 2-methylpropanoate (PubChem CID 134502371) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is 2-[4-(2-hydroxybutan-2-yl)phenyl]ethyl 2-methylpropanoate.
| Compound Name | 2-[4-(2-hydroxybutan-2-yl)phenyl]ethyl 2-methylpropanoate |
|---|---|
| PubChem CID | 134502371 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 2-[4-(2-hydroxybutan-2-yl)phenyl]ethyl 2-methylpropanoate |
| SMILES | CCC(C)(O)c1ccc(CCOC(=O)C(C)C)cc1 |
| InChI | InChI=1S/C16H24O3/c1-5-16(4,18)14-8-6-13(7-9-14)10-11-19-15(17)12(2)3/h6-9,12,18H,5,10-11H2,1-4H3 |
| InChIKey | LENKXFMJPCIRJR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |