C12H18S — CID 134527831
(3E,5Z)-4,8-dimethyl-5-methylsulfanylnona-1,3,5,7-tetraene (PubChem CID 134527831) has the molecular formula C12H18S and a molecular weight of 194.34 g/mol. Its IUPAC name is (3E,5Z)-4,8-dimethyl-5-methylsulfanylnona-1,3,5,7-tetraene.
| Compound Name | (3E,5Z)-4,8-dimethyl-5-methylsulfanylnona-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 134527831 |
| Molecular Formula | C12H18S |
| Molecular Weight | 194.34 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | (3E,5Z)-4,8-dimethyl-5-methylsulfanylnona-1,3,5,7-tetraene |
| SMILES | C=C/C=C(C)/C(=C/C=C(C)C)SC |
| InChI | InChI=1S/C12H18S/c1-6-7-11(4)12(13-5)9-8-10(2)3/h6-9H,1H2,2-5H3/b11-7+,12-9- |
| InChIKey | JDBDWSKSYKWHGF-WSWPAOCJSA-N |
| XLogP | 4.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.34 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|