C38H34F2N4S3 — CID 134531210
4,9-bis[5-(2-fluoro-4-pentylphenyl)thiophen-2-yl]-[1,2,5]thiadiazolo[3,4-g]quinoxaline (PubChem CID 134531210) has the molecular formula C38H34F2N4S3 and a molecular weight of 680.92 g/mol. Its IUPAC name is 4,9-bis[5-(2-fluoro-4-pentylphenyl)thiophen-2-yl]-[1,2,5]thiadiazolo[3,4-g]quinoxaline.
| Compound Name | 4,9-bis[5-(2-fluoro-4-pentylphenyl)thiophen-2-yl]-[1,2,5]thiadiazolo[3,4-g]quinoxaline |
|---|---|
| PubChem CID | 134531210 |
| Molecular Formula | C38H34F2N4S3 |
| Molecular Weight | 680.92 g/mol |
| Exact Mass | 680.19 |
| IUPAC Name | 4,9-bis[5-(2-fluoro-4-pentylphenyl)thiophen-2-yl]-[1,2,5]thiadiazolo[3,4-g]quinoxaline |
| SMILES | CCCCCc1ccc(-c2ccc(-c3c4nccnc4c(-c4ccc(-c5ccc(CCCCC)cc5F)s4)c4nsnc34)s2)c(F)c1 |
| InChI | InChI=1S/C38H34F2N4S3/c1-3-5-7-9-23-11-13-25(27(39)21-23)29-15-17-31(45-29)33-35-36(42-20-19-41-35)34(38-37(33)43-47-44-38)32-18-16-30(46-32)26-14-12-24(22-28(26)40)10-8-6-4-2/h11-22H,3-10H2,1-2H3 |
| InChIKey | DDTUVHLBZPYRGS-UHFFFAOYSA-N |
| XLogP | 12.17 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.92 |
| LogP ≤ 5 | 12.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|