C17H32N8O2S2 — CID 134533584
methyl N'-(2-morpholin-4-ylethyl)-N-[(E)-[(2E)-2-(2-morpholin-4-ylethylcarbamothioylhydrazinylidene)ethylidene]amino]carbamimidothioate (PubChem CID 134533584) has the molecular formula C17H32N8O2S2 and a molecular weight of 444.63 g/mol. Its IUPAC name is methyl N'-(2-morpholin-4-ylethyl)-N-[(E)-[(2E)-2-(2-morpholin-4-ylethylcarbamothioylhydrazinylidene)ethylidene]amino]carbamimidothioate.
| Compound Name | methyl N'-(2-morpholin-4-ylethyl)-N-[(E)-[(2E)-2-(2-morpholin-4-ylethylcarbamothioylhydrazinylidene)ethylidene]amino]carbamimidothioate |
|---|---|
| PubChem CID | 134533584 |
| Molecular Formula | C17H32N8O2S2 |
| Molecular Weight | 444.63 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | methyl N'-(2-morpholin-4-ylethyl)-N-[(E)-[(2E)-2-(2-morpholin-4-ylethylcarbamothioylhydrazinylidene)ethylidene]amino]carbamimidothioate |
| SMILES | CS/C(=N\CCN1CCOCC1)N/N=C/C=N/NC(=S)NCCN1CCOCC1 |
| InChI | InChI=1S/C17H32N8O2S2/c1-29-17(19-5-7-25-10-14-27-15-11-25)23-21-3-2-20-22-16(28)18-4-6-24-8-12-26-13-9-24/h2-3H,4-15H2,1H3,(H,19,23)(H2,18,22,28)/b20-2+,21-3+ |
| InChIKey | LAUNHEUSHIAXDK-DKSNCLFUSA-N |
| XLogP | -0.60 |
| TPSA | 98.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.63 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|