C35H39FN6O6 — CID 134559773
N-[4-[3-[(2,6-dioxopiperidin-3-yl)-formylcarbamoyl]-4-methylanilino]butyl]-5-[(E)-2-(5-fluoro-2-formamidophenyl)prop-1-enyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide (PubChem CID 134559773) has the molecular formula C35H39FN6O6 and a molecular weight of 658.73 g/mol. Its IUPAC name is N-[4-[3-[(2,6-dioxopiperidin-3-yl)-formylcarbamoyl]-4-methylanilino]butyl]-5-[(E)-2-(5-fluoro-2-formamidophenyl)prop-1-enyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide.
| Compound Name | N-[4-[3-[(2,6-dioxopiperidin-3-yl)-formylcarbamoyl]-4-methylanilino]butyl]-5-[(E)-2-(5-fluoro-2-formamidophenyl)prop-1-enyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 134559773 |
| Molecular Formula | C35H39FN6O6 |
| Molecular Weight | 658.73 g/mol |
| Exact Mass | 658.29 |
| IUPAC Name | N-[4-[3-[(2,6-dioxopiperidin-3-yl)-formylcarbamoyl]-4-methylanilino]butyl]-5-[(E)-2-(5-fluoro-2-formamidophenyl)prop-1-enyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide |
| SMILES | C/C(=C\c1[nH]c(C)c(C(=O)NCCCCNc2ccc(C)c(C(=O)N(C=O)C3CCC(=O)NC3=O)c2)c1C)c1cc(F)ccc1NC=O |
| InChI | InChI=1S/C35H39FN6O6/c1-20-7-9-25(17-27(20)35(48)42(19-44)30-11-12-31(45)41-33(30)46)37-13-5-6-14-38-34(47)32-22(3)29(40-23(32)4)15-21(2)26-16-24(36)8-10-28(26)39-18-43/h7-10,15-19,30,37,40H,5-6,11-14H2,1-4H3,(H,38,47)(H,39,43)(H,41,45,46)/b21-15+ |
| InChIKey | GIULLMYVKXPUPK-RCCKNPSSSA-N |
| XLogP | 4.23 |
| TPSA | 169.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.73 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|