C28H39N5O3 — CID 143059241
5-[(E)-2-(2-formamido-5-methylphenyl)prop-1-enyl]-2,4-dimethyl-N-(6-oxo-6-piperazin-1-ylhexyl)-1H-pyrrole-3-carboxamide (PubChem CID 143059241) has the molecular formula C28H39N5O3 and a molecular weight of 493.65 g/mol. Its IUPAC name is 5-[(E)-2-(2-formamido-5-methylphenyl)prop-1-enyl]-2,4-dimethyl-N-(6-oxo-6-piperazin-1-ylhexyl)-1H-pyrrole-3-carboxamide.
| Compound Name | 5-[(E)-2-(2-formamido-5-methylphenyl)prop-1-enyl]-2,4-dimethyl-N-(6-oxo-6-piperazin-1-ylhexyl)-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 143059241 |
| Molecular Formula | C28H39N5O3 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.31 |
| IUPAC Name | 5-[(E)-2-(2-formamido-5-methylphenyl)prop-1-enyl]-2,4-dimethyl-N-(6-oxo-6-piperazin-1-ylhexyl)-1H-pyrrole-3-carboxamide |
| SMILES | C/C(=C\c1[nH]c(C)c(C(=O)NCCCCCC(=O)N2CCNCC2)c1C)c1cc(C)ccc1NC=O |
| InChI | InChI=1S/C28H39N5O3/c1-19-9-10-24(31-18-34)23(16-19)20(2)17-25-21(3)27(22(4)32-25)28(36)30-11-7-5-6-8-26(35)33-14-12-29-13-15-33/h9-10,16-18,29,32H,5-8,11-15H2,1-4H3,(H,30,36)(H,31,34)/b20-17+ |
| InChIKey | WECAQSGVTSRUMA-LVZFUZTISA-N |
| XLogP | 3.79 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|