C17H17FN2O3 — CID 155719114
5-[(E)-2-(5-fluoro-2-formamidophenyl)prop-1-enyl]-2,4-dimethyl-1H-pyrrole-3-carboxylic acid (PubChem CID 155719114) has the molecular formula C17H17FN2O3 and a molecular weight of 316.33 g/mol. Its IUPAC name is 5-[(E)-2-(5-fluoro-2-formamidophenyl)prop-1-enyl]-2,4-dimethyl-1H-pyrrole-3-carboxylic acid.
| Compound Name | 5-[(E)-2-(5-fluoro-2-formamidophenyl)prop-1-enyl]-2,4-dimethyl-1H-pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 155719114 |
| Molecular Formula | C17H17FN2O3 |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 5-[(E)-2-(5-fluoro-2-formamidophenyl)prop-1-enyl]-2,4-dimethyl-1H-pyrrole-3-carboxylic acid |
| SMILES | C/C(=C\c1[nH]c(C)c(C(=O)O)c1C)c1cc(F)ccc1NC=O |
| InChI | InChI=1S/C17H17FN2O3/c1-9(13-7-12(18)4-5-14(13)19-8-21)6-15-10(2)16(17(22)23)11(3)20-15/h4-8,20H,1-3H3,(H,19,21)(H,22,23)/b9-6+ |
| InChIKey | VULDNUHFCIQHMG-RMKNXTFCSA-N |
| XLogP | 3.60 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|