C17H15N3O2S2 — CID 134563722
2-(7-aminobenzo[g][1,3]benzothiazol-2-yl)-5,5-dimethyl-4H-1,3-thiazole-4-carboxylic acid (PubChem CID 134563722) has the molecular formula C17H15N3O2S2 and a molecular weight of 357.46 g/mol. Its IUPAC name is 2-(7-aminobenzo[g][1,3]benzothiazol-2-yl)-5,5-dimethyl-4H-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-(7-aminobenzo[g][1,3]benzothiazol-2-yl)-5,5-dimethyl-4H-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 134563722 |
| Molecular Formula | C17H15N3O2S2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | 2-(7-aminobenzo[g][1,3]benzothiazol-2-yl)-5,5-dimethyl-4H-1,3-thiazole-4-carboxylic acid |
| SMILES | CC1(C)SC(c2nc3ccc4cc(N)ccc4c3s2)=NC1C(=O)O |
| InChI | InChI=1S/C17H15N3O2S2/c1-17(2)13(16(21)22)20-15(24-17)14-19-11-6-3-8-7-9(18)4-5-10(8)12(11)23-14/h3-7,13H,18H2,1-2H3,(H,21,22) |
| InChIKey | FWRZLSGXVGEFQS-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 88.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|