C31H34FN5O5 — CID 134566590
2-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinazolin-4-yl]oxyanilino]-2-hydroxy-N-(2-phenylethyl)acetamide (PubChem CID 134566590) has the molecular formula C31H34FN5O5 and a molecular weight of 575.64 g/mol. Its IUPAC name is 2-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinazolin-4-yl]oxyanilino]-2-hydroxy-N-(2-phenylethyl)acetamide.
| Compound Name | 2-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinazolin-4-yl]oxyanilino]-2-hydroxy-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 134566590 |
| Molecular Formula | C31H34FN5O5 |
| Molecular Weight | 575.64 g/mol |
| Exact Mass | 575.25 |
| IUPAC Name | 2-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinazolin-4-yl]oxyanilino]-2-hydroxy-N-(2-phenylethyl)acetamide |
| SMILES | COc1cc2c(Oc3ccc(NC(O)C(=O)NCCc4ccccc4)cc3F)ncnc2cc1OCC1CCNCC1 |
| InChI | InChI=1S/C31H34FN5O5/c1-40-27-16-23-25(17-28(27)41-18-21-9-12-33-13-10-21)35-19-36-31(23)42-26-8-7-22(15-24(26)32)37-30(39)29(38)34-14-11-20-5-3-2-4-6-20/h2-8,15-17,19,21,30,33,37,39H,9-14,18H2,1H3,(H,34,38) |
| InChIKey | UHKOLBRBMGTLSL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 126.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.64 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|