C27H18N6O6 — CID 134573877
[3-[3-(3-cyanato-2-methylphenyl)-5-(3-isocyanato-2-methylphenyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]-2-methylphenyl] cyanate (PubChem CID 134573877) has the molecular formula C27H18N6O6 and a molecular weight of 522.48 g/mol. Its IUPAC name is [3-[3-(3-cyanato-2-methylphenyl)-5-(3-isocyanato-2-methylphenyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]-2-methylphenyl] cyanate.
| Compound Name | [3-[3-(3-cyanato-2-methylphenyl)-5-(3-isocyanato-2-methylphenyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]-2-methylphenyl] cyanate |
|---|---|
| PubChem CID | 134573877 |
| Molecular Formula | C27H18N6O6 |
| Molecular Weight | 522.48 g/mol |
| Exact Mass | 522.13 |
| IUPAC Name | [3-[3-(3-cyanato-2-methylphenyl)-5-(3-isocyanato-2-methylphenyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]-2-methylphenyl] cyanate |
| SMILES | Cc1c(N=C=O)cccc1-n1c(=O)n(-c2cccc(OC#N)c2C)c(=O)n(-c2cccc(OC#N)c2C)c1=O |
| InChI | InChI=1S/C27H18N6O6/c1-16-19(30-15-34)7-4-8-20(16)31-25(35)32(21-9-5-11-23(17(21)2)38-13-28)27(37)33(26(31)36)22-10-6-12-24(18(22)3)39-14-29/h4-12H,1-3H3 |
| InChIKey | LNORDQOUVZHKLZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 161.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.48 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|