C13H20O — CID 134612775
(2S,5S,9R,10S)-2,6,9,10-tetramethyl-1-oxaspiro[4.5]deca-3,6-diene (PubChem CID 134612775) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is (2S,5S,9R,10S)-2,6,9,10-tetramethyl-1-oxaspiro[4.5]deca-3,6-diene.
| Compound Name | (2S,5S,9R,10S)-2,6,9,10-tetramethyl-1-oxaspiro[4.5]deca-3,6-diene |
|---|---|
| PubChem CID | 134612775 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | (2S,5S,9R,10S)-2,6,9,10-tetramethyl-1-oxaspiro[4.5]deca-3,6-diene |
| SMILES | CC1=CC[C@@H](C)[C@H](C)[C@@]12C=C[C@H](C)O2 |
| InChI | InChI=1S/C13H20O/c1-9-5-6-10(2)13(12(9)4)8-7-11(3)14-13/h6-9,11-12H,5H2,1-4H3/t9-,11+,12+,13-/m1/s1 |
| InChIKey | WYTVJTNOJJKEEQ-LPTSXCQYSA-N |
| XLogP | 3.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|