C15H28O — CID 21450092
2-methyl-5,5-dipentyl-2H-furan (PubChem CID 21450092) has the molecular formula C15H28O and a molecular weight of 224.39 g/mol. Its IUPAC name is 2-methyl-5,5-dipentyl-2H-furan.
| Compound Name | 2-methyl-5,5-dipentyl-2H-furan |
|---|---|
| PubChem CID | 21450092 |
| Molecular Formula | C15H28O |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.21 |
| IUPAC Name | 2-methyl-5,5-dipentyl-2H-furan |
| SMILES | CCCCCC1(CCCCC)C=CC(C)O1 |
| InChI | InChI=1S/C15H28O/c1-4-6-8-11-15(12-9-7-5-2)13-10-14(3)16-15/h10,13-14H,4-9,11-12H2,1-3H3 |
| InChIKey | KRLOGXOSEFSGTQ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|