C20H16O2 — CID 134612835
5-(3-methylbuta-1,3-dien-2-yl)-2-phenylchromen-4-one (PubChem CID 134612835) has the molecular formula C20H16O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is 5-(3-methylbuta-1,3-dien-2-yl)-2-phenylchromen-4-one.
| Compound Name | 5-(3-methylbuta-1,3-dien-2-yl)-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 134612835 |
| Molecular Formula | C20H16O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 5-(3-methylbuta-1,3-dien-2-yl)-2-phenylchromen-4-one |
| SMILES | C=C(C)C(=C)c1cccc2oc(-c3ccccc3)cc(=O)c12 |
| InChI | InChI=1S/C20H16O2/c1-13(2)14(3)16-10-7-11-18-20(16)17(21)12-19(22-18)15-8-5-4-6-9-15/h4-12H,1,3H2,2H3 |
| InChIKey | TYKHVHCXQZAXPI-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|