C17H24N2O2 — CID 134612909
tert-butyl (7Z)-2-phenyl-3,4,5,6-tetrahydrodiazocine-1-carboxylate (PubChem CID 134612909) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is tert-butyl (7Z)-2-phenyl-3,4,5,6-tetrahydrodiazocine-1-carboxylate.
| Compound Name | tert-butyl (7Z)-2-phenyl-3,4,5,6-tetrahydrodiazocine-1-carboxylate |
|---|---|
| PubChem CID | 134612909 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | tert-butyl (7Z)-2-phenyl-3,4,5,6-tetrahydrodiazocine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1/C=C\CCCCN1c1ccccc1 |
| InChI | InChI=1S/C17H24N2O2/c1-17(2,3)21-16(20)19-14-10-5-4-9-13-18(19)15-11-7-6-8-12-15/h6-8,10-12,14H,4-5,9,13H2,1-3H3/b14-10- |
| InChIKey | XGECDGFRGUEKKD-UVTDQMKNSA-N |
| XLogP | 4.34 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |