C27H21N3O — CID 13465999
N-(1-cyano-1,2-diphenylethyl)-N-pyridin-2-ylbenzamide (PubChem CID 13465999) has the molecular formula C27H21N3O and a molecular weight of 403.49 g/mol. Its IUPAC name is N-(1-cyano-1,2-diphenylethyl)-N-pyridin-2-ylbenzamide.
| Compound Name | N-(1-cyano-1,2-diphenylethyl)-N-pyridin-2-ylbenzamide |
|---|---|
| PubChem CID | 13465999 |
| Molecular Formula | C27H21N3O |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | N-(1-cyano-1,2-diphenylethyl)-N-pyridin-2-ylbenzamide |
| SMILES | N#CC(Cc1ccccc1)(c1ccccc1)N(C(=O)c1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C27H21N3O/c28-21-27(24-16-8-3-9-17-24,20-22-12-4-1-5-13-22)30(25-18-10-11-19-29-25)26(31)23-14-6-2-7-15-23/h1-19H,20H2 |
| InChIKey | CWKYXTJBWYYHER-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |