C16H24O6S — CID 13467776
2-[1-(benzenesulfonyl)-2-(2-methoxyethoxymethoxy)cyclopropyl]propan-2-ol (PubChem CID 13467776) has the molecular formula C16H24O6S and a molecular weight of 344.43 g/mol. Its IUPAC name is 2-[1-(benzenesulfonyl)-2-(2-methoxyethoxymethoxy)cyclopropyl]propan-2-ol.
| Compound Name | 2-[1-(benzenesulfonyl)-2-(2-methoxyethoxymethoxy)cyclopropyl]propan-2-ol |
|---|---|
| PubChem CID | 13467776 |
| Molecular Formula | C16H24O6S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 2-[1-(benzenesulfonyl)-2-(2-methoxyethoxymethoxy)cyclopropyl]propan-2-ol |
| SMILES | COCCOCOC1CC1(C(C)(C)O)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H24O6S/c1-15(2,17)16(11-14(16)22-12-21-10-9-20-3)23(18,19)13-7-5-4-6-8-13/h4-8,14,17H,9-12H2,1-3H3 |
| InChIKey | KTRVUFWDHPWAKE-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|