C16H24O6S — CID 134937673
(2R,3R)-2-(benzenesulfonyl)-3-[1-(2-methoxyethoxymethoxy)-2-methylpropyl]oxirane (PubChem CID 134937673) has the molecular formula C16H24O6S and a molecular weight of 344.43 g/mol. Its IUPAC name is (2R,3R)-2-(benzenesulfonyl)-3-[1-(2-methoxyethoxymethoxy)-2-methylpropyl]oxirane.
| Compound Name | (2R,3R)-2-(benzenesulfonyl)-3-[1-(2-methoxyethoxymethoxy)-2-methylpropyl]oxirane |
|---|---|
| PubChem CID | 134937673 |
| Molecular Formula | C16H24O6S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (2R,3R)-2-(benzenesulfonyl)-3-[1-(2-methoxyethoxymethoxy)-2-methylpropyl]oxirane |
| SMILES | COCCOCOC(C(C)C)[C@H]1O[C@@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H24O6S/c1-12(2)14(21-11-20-10-9-19-3)15-16(22-15)23(17,18)13-7-5-4-6-8-13/h4-8,12,14-16H,9-11H2,1-3H3/t14?,15-,16-/m1/s1 |
| InChIKey | DQNWPWAJWUBTLA-ANGDWKNPSA-N |
| XLogP | 1.85 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|