C26H29N3O3 — CID 134710720
N'-(3-ethylphenyl)-N-[(3R,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]butanediamide (PubChem CID 134710720) has the molecular formula C26H29N3O3 and a molecular weight of 431.54 g/mol. Its IUPAC name is N'-(3-ethylphenyl)-N-[(3R,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]butanediamide.
| Compound Name | N'-(3-ethylphenyl)-N-[(3R,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]butanediamide |
|---|---|
| PubChem CID | 134710720 |
| Molecular Formula | C26H29N3O3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | N'-(3-ethylphenyl)-N-[(3R,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]butanediamide |
| SMILES | CCc1cccc(NC(=O)CCC(=O)N[C@H]2COC[C@H]2Cc2ccnc3ccccc23)c1 |
| InChI | InChI=1S/C26H29N3O3/c1-2-18-6-5-7-21(14-18)28-25(30)10-11-26(31)29-24-17-32-16-20(24)15-19-12-13-27-23-9-4-3-8-22(19)23/h3-9,12-14,20,24H,2,10-11,15-17H2,1H3,(H,28,30)(H,29,31)/t20-,24+/m1/s1 |
| InChIKey | BJYMRNJTHPUFJC-YKSBVNFPSA-N |
| XLogP | 3.89 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |