C17H17N5O2S — CID 134824244
4-[4-(2,3-dihydroindol-1-ylmethyl)triazol-1-yl]benzenesulfonamide (PubChem CID 134824244) has the molecular formula C17H17N5O2S and a molecular weight of 355.42 g/mol. Its IUPAC name is 4-[4-(2,3-dihydroindol-1-ylmethyl)triazol-1-yl]benzenesulfonamide.
| Compound Name | 4-[4-(2,3-dihydroindol-1-ylmethyl)triazol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 134824244 |
| Molecular Formula | C17H17N5O2S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 4-[4-(2,3-dihydroindol-1-ylmethyl)triazol-1-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-n2cc(CN3CCc4ccccc43)nn2)cc1 |
| InChI | InChI=1S/C17H17N5O2S/c18-25(23,24)16-7-5-15(6-8-16)22-12-14(19-20-22)11-21-10-9-13-3-1-2-4-17(13)21/h1-8,12H,9-11H2,(H2,18,23,24) |
| InChIKey | CSQLPGVVVSRWHL-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |