C21H29N2+ — CID 134828227
2-(6,11-dihydrobenzo[c][1]benzazepin-5-yl)ethyl-diethyl-methylazanium (PubChem CID 134828227) has the molecular formula C21H29N2+ and a molecular weight of 309.48 g/mol. Its IUPAC name is 2-(6,11-dihydrobenzo[c][1]benzazepin-5-yl)ethyl-diethyl-methylazanium.
| Compound Name | 2-(6,11-dihydrobenzo[c][1]benzazepin-5-yl)ethyl-diethyl-methylazanium |
|---|---|
| PubChem CID | 134828227 |
| Molecular Formula | C21H29N2+ |
| Molecular Weight | 309.48 g/mol |
| Exact Mass | 309.23 |
| IUPAC Name | 2-(6,11-dihydrobenzo[c][1]benzazepin-5-yl)ethyl-diethyl-methylazanium |
| SMILES | CC[N+](C)(CC)CCN1Cc2ccccc2Cc2ccccc21 |
| InChI | InChI=1S/C21H29N2/c1-4-23(3,5-2)15-14-22-17-20-12-7-6-10-18(20)16-19-11-8-9-13-21(19)22/h6-13H,4-5,14-17H2,1-3H3/q+1 |
| InChIKey | QXGXNWSKUCPVGD-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.48 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|