C16H16NPd+ — CID 134830935
palladium(2+);1-(phenylmethyl)-2,3,4,8-tetrahydroquinolin-1-ium-8-ide (PubChem CID 134830935) has the molecular formula C16H16NPd+ and a molecular weight of 328.73 g/mol. Its IUPAC name is palladium(2+);1-(phenylmethyl)-2,3,4,8-tetrahydroquinolin-1-ium-8-ide.
| Compound Name | palladium(2+);1-(phenylmethyl)-2,3,4,8-tetrahydroquinolin-1-ium-8-ide |
|---|---|
| PubChem CID | 134830935 |
| Molecular Formula | C16H16NPd+ |
| Molecular Weight | 328.73 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | palladium(2+);1-(phenylmethyl)-2,3,4,8-tetrahydroquinolin-1-ium-8-ide |
| SMILES | [Pd+2].[c-]1ccccc1C[N+]1=C2[CH-]C=CC=C2CCC1 |
| InChI | InChI=1S/C16H16N.Pd/c1-2-7-14(8-3-1)13-17-12-6-10-15-9-4-5-11-16(15)17;/h1-5,7,9,11H,6,10,12-13H2;/q-1;+2 |
| InChIKey | NZZPFJFRJVTOCV-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.73 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|