C21H26F3NO6 — CID 134831715
[(Z)-3-[(3aS,4R,6S,7R,7aS)-6-methoxy-2,2-dimethyl-7-phenylmethoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]prop-2-enyl] 2,2,2-trifluoroethanimidate (PubChem CID 134831715) has the molecular formula C21H26F3NO6 and a molecular weight of 445.43 g/mol. Its IUPAC name is [(Z)-3-[(3aS,4R,6S,7R,7aS)-6-methoxy-2,2-dimethyl-7-phenylmethoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]prop-2-enyl] 2,2,2-trifluoroethanimidate.
| Compound Name | [(Z)-3-[(3aS,4R,6S,7R,7aS)-6-methoxy-2,2-dimethyl-7-phenylmethoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]prop-2-enyl] 2,2,2-trifluoroethanimidate |
|---|---|
| PubChem CID | 134831715 |
| Molecular Formula | C21H26F3NO6 |
| Molecular Weight | 445.43 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | [(Z)-3-[(3aS,4R,6S,7R,7aS)-6-methoxy-2,2-dimethyl-7-phenylmethoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]prop-2-enyl] 2,2,2-trifluoroethanimidate |
| SMILES | [H]/N=C(/OC/C=C\[C@H]1O[C@H](OC)[C@H](OCc2ccccc2)[C@H]2OC(C)(C)O[C@H]21)C(F)(F)F |
| InChI | InChI=1S/C21H26F3NO6/c1-20(2)30-15-14(10-7-11-27-19(25)21(22,23)24)29-18(26-3)17(16(15)31-20)28-12-13-8-5-4-6-9-13/h4-10,14-18,25H,11-12H2,1-3H3/b10-7-,25-19+/t14-,15+,16+,17-,18+/m1/s1 |
| InChIKey | MGHMBHXJSAVESW-SCTXIKAGSA-N |
| XLogP | 3.58 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.43 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|