C16H24O5 — CID 134832471
tert-butyl (3aS,5S,6S,6aS)-2,2-dimethyl-4-oxo-6-[(E)-prop-1-enyl]-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxole-5-carboxylate (PubChem CID 134832471) has the molecular formula C16H24O5 and a molecular weight of 296.36 g/mol. Its IUPAC name is tert-butyl (3aS,5S,6S,6aS)-2,2-dimethyl-4-oxo-6-[(E)-prop-1-enyl]-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxole-5-carboxylate.
| Compound Name | tert-butyl (3aS,5S,6S,6aS)-2,2-dimethyl-4-oxo-6-[(E)-prop-1-enyl]-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxole-5-carboxylate |
|---|---|
| PubChem CID | 134832471 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | tert-butyl (3aS,5S,6S,6aS)-2,2-dimethyl-4-oxo-6-[(E)-prop-1-enyl]-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxole-5-carboxylate |
| SMILES | C/C=C/[C@H]1[C@H](C(=O)OC(C)(C)C)C(=O)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C16H24O5/c1-7-8-9-10(14(18)21-15(2,3)4)11(17)13-12(9)19-16(5,6)20-13/h7-10,12-13H,1-6H3/b8-7+/t9-,10-,12-,13+/m0/s1 |
| InChIKey | HTCKLNAQENNZIQ-AJTIARLFSA-N |
| XLogP | 2.24 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|