C21H25NO8 — CID 44604923
tert-butyl (3aR,5S,6S,6aR)-6-[(1,3-dioxoisoindol-2-yl)oxymethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-5-carboxylate (PubChem CID 44604923) has the molecular formula C21H25NO8 and a molecular weight of 419.43 g/mol. Its IUPAC name is tert-butyl (3aR,5S,6S,6aR)-6-[(1,3-dioxoisoindol-2-yl)oxymethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-5-carboxylate.
| Compound Name | tert-butyl (3aR,5S,6S,6aR)-6-[(1,3-dioxoisoindol-2-yl)oxymethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-5-carboxylate |
|---|---|
| PubChem CID | 44604923 |
| Molecular Formula | C21H25NO8 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | tert-butyl (3aR,5S,6S,6aR)-6-[(1,3-dioxoisoindol-2-yl)oxymethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@@H]1CON1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H25NO8/c1-20(2,3)29-18(25)14-13(15-19(27-14)30-21(4,5)28-15)10-26-22-16(23)11-8-6-7-9-12(11)17(22)24/h6-9,13-15,19H,10H2,1-5H3/t13-,14+,15-,19-/m1/s1 |
| InChIKey | FBOMKDPNVREACL-NXEZDXNNSA-N |
| XLogP | 2.05 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|