C32H43NO5Se — CID 134836111
tert-butyl (2R,6S)-2-[(E)-2-[(3S,3aS,6R,7aS)-3-methyl-1-oxo-6-(4-oxo-4-phenylselanylbutyl)-3a,6,7,7a-tetrahydro-3H-2-benzofuran-4-yl]ethenyl]-6-methylpiperidine-1-carboxylate (PubChem CID 134836111) has the molecular formula C32H43NO5Se and a molecular weight of 600.66 g/mol. Its IUPAC name is tert-butyl (2R,6S)-2-[(E)-2-[(3S,3aS,6R,7aS)-3-methyl-1-oxo-6-(4-oxo-4-phenylselanylbutyl)-3a,6,7,7a-tetrahydro-3H-2-benzofuran-4-yl]ethenyl]-6-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (2R,6S)-2-[(E)-2-[(3S,3aS,6R,7aS)-3-methyl-1-oxo-6-(4-oxo-4-phenylselanylbutyl)-3a,6,7,7a-tetrahydro-3H-2-benzofuran-4-yl]ethenyl]-6-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 134836111 |
| Molecular Formula | C32H43NO5Se |
| Molecular Weight | 600.66 g/mol |
| Exact Mass | 601.23 |
| IUPAC Name | tert-butyl (2R,6S)-2-[(E)-2-[(3S,3aS,6R,7aS)-3-methyl-1-oxo-6-(4-oxo-4-phenylselanylbutyl)-3a,6,7,7a-tetrahydro-3H-2-benzofuran-4-yl]ethenyl]-6-methylpiperidine-1-carboxylate |
| SMILES | C[C@@H]1OC(=O)[C@H]2C[C@@H](CCCC(=O)[Se]c3ccccc3)C=C(/C=C/[C@H]3CCC[C@H](C)N3C(=O)OC(C)(C)C)[C@@H]12 |
| InChI | InChI=1S/C32H43NO5Se/c1-21-11-9-13-25(33(21)31(36)38-32(3,4)5)18-17-24-19-23(20-27-29(24)22(2)37-30(27)35)12-10-16-28(34)39-26-14-7-6-8-15-26/h6-8,14-15,17-19,21-23,25,27,29H,9-13,16,20H2,1-5H3/b18-17+/t21-,22-,23-,25+,27-,29+/m0/s1 |
| InChIKey | YWAZKDDWVHDHMI-RELKPDDDSA-N |
| XLogP | 5.57 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.66 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|