C28H52N2O4 — CID 134836211
tert-butyl N-[(E)-dec-1-enyl]-N-[(2-methylpropan-2-yl)oxycarbonyl-[(E)-oct-4-en-4-yl]amino]carbamate (PubChem CID 134836211) has the molecular formula C28H52N2O4 and a molecular weight of 480.73 g/mol. Its IUPAC name is tert-butyl N-[(E)-dec-1-enyl]-N-[(2-methylpropan-2-yl)oxycarbonyl-[(E)-oct-4-en-4-yl]amino]carbamate.
| Compound Name | tert-butyl N-[(E)-dec-1-enyl]-N-[(2-methylpropan-2-yl)oxycarbonyl-[(E)-oct-4-en-4-yl]amino]carbamate |
|---|---|
| PubChem CID | 134836211 |
| Molecular Formula | C28H52N2O4 |
| Molecular Weight | 480.73 g/mol |
| Exact Mass | 480.39 |
| IUPAC Name | tert-butyl N-[(E)-dec-1-enyl]-N-[(2-methylpropan-2-yl)oxycarbonyl-[(E)-oct-4-en-4-yl]amino]carbamate |
| SMILES | CCC/C=C(\CCC)N(C(=O)OC(C)(C)C)N(/C=C/CCCCCCCC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H52N2O4/c1-10-13-15-16-17-18-19-20-23-29(25(31)33-27(4,5)6)30(26(32)34-28(7,8)9)24(21-12-3)22-14-11-2/h20,22-23H,10-19,21H2,1-9H3/b23-20+,24-22+ |
| InChIKey | CFVKTFFNGKBTNZ-FWOYJBNGSA-N |
| XLogP | 9.12 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.73 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|