C32H33NO5 — CID 134837605
(2R,3R)-4-hydroxy-N-methoxy-N-methyl-4,4-diphenyl-2,3-bis(phenylmethoxy)butanamide (PubChem CID 134837605) has the molecular formula C32H33NO5 and a molecular weight of 511.62 g/mol. Its IUPAC name is (2R,3R)-4-hydroxy-N-methoxy-N-methyl-4,4-diphenyl-2,3-bis(phenylmethoxy)butanamide.
| Compound Name | (2R,3R)-4-hydroxy-N-methoxy-N-methyl-4,4-diphenyl-2,3-bis(phenylmethoxy)butanamide |
|---|---|
| PubChem CID | 134837605 |
| Molecular Formula | C32H33NO5 |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | (2R,3R)-4-hydroxy-N-methoxy-N-methyl-4,4-diphenyl-2,3-bis(phenylmethoxy)butanamide |
| SMILES | CON(C)C(=O)[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H33NO5/c1-33(36-2)31(34)29(37-23-25-15-7-3-8-16-25)30(38-24-26-17-9-4-10-18-26)32(35,27-19-11-5-12-20-27)28-21-13-6-14-22-28/h3-22,29-30,35H,23-24H2,1-2H3/t29-,30-/m1/s1 |
| InChIKey | QERLYIGAACUFLN-LOYHVIPDSA-N |
| XLogP | 5.11 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|